C25H24O12 — CID 74222227
4-[3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl]oxy-4-oxobutanoic acid (PubChem CID 74222227) has the molecular formula C25H24O12 and a molecular weight of 516.46 g/mol. Its IUPAC name is 4-[3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 74222227 |
| Molecular Formula | C25H24O12 |
| Molecular Weight | 516.46 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 4-[3-(4-hydroxyphenyl)-4-oxo-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-7-yl]oxy-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Oc1ccc2c(=O)c(-c3ccc(O)cc3)coc2c1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C25H24O12/c26-9-16-21(32)22(33)23(34)25(37-16)19-15(36-18(30)8-7-17(28)29)6-5-13-20(31)14(10-35-24(13)19)11-1-3-12(27)4-2-11/h1-6,10,16,21-23,25-27,32-34H,7-9H2,(H,28,29)/t16-,21-,22+,23-,25+/m1/s1 |
| InChIKey | UMHJCQVWUVLMHI-IOOJMYGHSA-N |
| XLogP | 0.45 |
| TPSA | 204.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.46 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|