C17H12BrNO3 — CID 53376644
(2E,4E)-1-(4-bromo-3-nitrophenyl)-5-phenylpenta-2,4-dien-1-one (PubChem CID 53376644) has the molecular formula C17H12BrNO3 and a molecular weight of 358.19 g/mol. Its IUPAC name is (2E,4E)-1-(4-bromo-3-nitrophenyl)-5-phenylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(4-bromo-3-nitrophenyl)-5-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 53376644 |
| Molecular Formula | C17H12BrNO3 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | (2E,4E)-1-(4-bromo-3-nitrophenyl)-5-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccccc1)c1ccc(Br)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12BrNO3/c18-15-11-10-14(12-16(15)19(21)22)17(20)9-5-4-8-13-6-2-1-3-7-13/h1-12H/b8-4+,9-5+ |
| InChIKey | CDQOZLVYGVXDPX-KBXRYBNXSA-N |
| XLogP | 4.81 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|