C29H23NO5S — CID 53376696
methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate (PubChem CID 53376696) has the molecular formula C29H23NO5S and a molecular weight of 497.57 g/mol. Its IUPAC name is methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
|---|---|
| PubChem CID | 53376696 |
| Molecular Formula | C29H23NO5S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | methyl 4-[[(5Z)-5-[[4-[(E)-3-(4-methylphenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C\c3ccc(/C=C/C(=O)c4ccc(C)cc4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C29H23NO5S/c1-19-3-12-23(13-4-19)25(31)16-11-20-5-7-21(8-6-20)17-26-27(32)30(29(34)36-26)18-22-9-14-24(15-10-22)28(33)35-2/h3-17H,18H2,1-2H3/b16-11+,26-17- |
| InChIKey | GLFSOXOPFLGRJA-QHEGJKBSSA-N |
| XLogP | 5.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|