C14H17Cl2N3O — CID 53378216
2-(4-butyltriazol-1-yl)-1-(2,4-dichlorophenyl)ethanol (PubChem CID 53378216) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-(4-butyltriazol-1-yl)-1-(2,4-dichlorophenyl)ethanol.
| Compound Name | 2-(4-butyltriazol-1-yl)-1-(2,4-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 53378216 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-(4-butyltriazol-1-yl)-1-(2,4-dichlorophenyl)ethanol |
| SMILES | CCCCc1cn(CC(O)c2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C14H17Cl2N3O/c1-2-3-4-11-8-19(18-17-11)9-14(20)12-6-5-10(15)7-13(12)16/h5-8,14,20H,2-4,9H2,1H3 |
| InChIKey | DLUWCRYGJZTSCI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |