C12H13Cl2N3O2 — CID 53378217
1-(2,4-dichlorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]ethanol (PubChem CID 53378217) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]ethanol.
| Compound Name | 1-(2,4-dichlorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 53378217 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-[4-(2-hydroxyethyl)triazol-1-yl]ethanol |
| SMILES | OCCc1cn(CC(O)c2ccc(Cl)cc2Cl)nn1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-8-1-2-10(11(14)5-8)12(19)7-17-6-9(3-4-18)15-16-17/h1-2,5-6,12,18-19H,3-4,7H2 |
| InChIKey | SSLNCOSXMZNJIO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |