C29H31N3O2 — CID 53383972
2-(1-benzofuran-2-yl)-N-(2,6-dimethylphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide (PubChem CID 53383972) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-N-(2,6-dimethylphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide.
| Compound Name | 2-(1-benzofuran-2-yl)-N-(2,6-dimethylphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 53383972 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-N-(2,6-dimethylphenyl)-2-[4-(4-methylphenyl)piperazin-1-yl]acetamide |
| SMILES | Cc1ccc(N2CCN(C(C(=O)Nc3c(C)cccc3C)c3cc4ccccc4o3)CC2)cc1 |
| InChI | InChI=1S/C29H31N3O2/c1-20-11-13-24(14-12-20)31-15-17-32(18-16-31)28(26-19-23-9-4-5-10-25(23)34-26)29(33)30-27-21(2)7-6-8-22(27)3/h4-14,19,28H,15-18H2,1-3H3,(H,30,33) |
| InChIKey | KLQDNYSELXLDKJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|