C21H15ClFNO — CID 53384954
(Z)-3-(3-chloro-2-fluoroanilino)-1,3-diphenylprop-2-en-1-one (PubChem CID 53384954) has the molecular formula C21H15ClFNO and a molecular weight of 351.81 g/mol. Its IUPAC name is (Z)-3-(3-chloro-2-fluoroanilino)-1,3-diphenylprop-2-en-1-one.
| Compound Name | (Z)-3-(3-chloro-2-fluoroanilino)-1,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 53384954 |
| Molecular Formula | C21H15ClFNO |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (Z)-3-(3-chloro-2-fluoroanilino)-1,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C=C(\Nc1cccc(Cl)c1F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15ClFNO/c22-17-12-7-13-18(21(17)23)24-19(15-8-3-1-4-9-15)14-20(25)16-10-5-2-6-11-16/h1-14,24H/b19-14- |
| InChIKey | ZRKJTHURXOQUGT-RGEXLXHISA-N |
| XLogP | 5.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|