C29H42N4O2 — CID 53385358
tert-butyl (3S)-4-[4-[(3S)-4-benzyl-3-methylpiperazin-1-yl]-3-methylphenyl]-3-methylpiperazine-1-carboxylate (PubChem CID 53385358) has the molecular formula C29H42N4O2 and a molecular weight of 478.68 g/mol. Its IUPAC name is tert-butyl (3S)-4-[4-[(3S)-4-benzyl-3-methylpiperazin-1-yl]-3-methylphenyl]-3-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-4-[4-[(3S)-4-benzyl-3-methylpiperazin-1-yl]-3-methylphenyl]-3-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 53385358 |
| Molecular Formula | C29H42N4O2 |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | tert-butyl (3S)-4-[4-[(3S)-4-benzyl-3-methylpiperazin-1-yl]-3-methylphenyl]-3-methylpiperazine-1-carboxylate |
| SMILES | Cc1cc(N2CCN(C(=O)OC(C)(C)C)C[C@@H]2C)ccc1N1CCN(Cc2ccccc2)[C@@H](C)C1 |
| InChI | InChI=1S/C29H42N4O2/c1-22-18-26(33-17-16-32(20-24(33)3)28(34)35-29(4,5)6)12-13-27(22)31-15-14-30(23(2)19-31)21-25-10-8-7-9-11-25/h7-13,18,23-24H,14-17,19-21H2,1-6H3/t23-,24-/m0/s1 |
| InChIKey | GELKVYRNSGANKT-ZEQRLZLVSA-N |
| XLogP | 5.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|