C26H30N6O3 — CID 53386406
1-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pyrazole-3-carboxylic acid (PubChem CID 53386406) has the molecular formula C26H30N6O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is 1-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 53386406 |
| Molecular Formula | C26H30N6O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | 1-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(-c2noc(-c3nn(C)c4c3CCC(C)(C)C4)n2)cc(C)c1CCn1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C26H30N6O3/c1-15-12-17(13-16(2)18(15)7-10-32-11-8-20(28-32)25(33)34)23-27-24(35-30-23)22-19-6-9-26(3,4)14-21(19)31(5)29-22/h8,11-13H,6-7,9-10,14H2,1-5H3,(H,33,34) |
| InChIKey | SQYZUDFUXIEACL-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 111.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |