C27H44O8Si — CID 53386686
[(2R,3R,4R,6S)-6-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] benzoate (PubChem CID 53386686) has the molecular formula C27H44O8Si and a molecular weight of 524.73 g/mol. Its IUPAC name is [(2R,3R,4R,6S)-6-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] benzoate.
| Compound Name | [(2R,3R,4R,6S)-6-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 53386686 |
| Molecular Formula | C27H44O8Si |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | [(2R,3R,4R,6S)-6-[(2S,3S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-4-methoxy-2-methyloxan-3-yl] benzoate |
| SMILES | CO[C@@H]1C[C@H](O[C@H]2[C@H](C)OC(O)C[C@]2(C)O[Si](C)(C)C(C)(C)C)O[C@H](C)[C@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H44O8Si/c1-17-23(34-25(29)19-13-11-10-12-14-19)20(30-7)15-22(32-17)33-24-18(2)31-21(28)16-27(24,6)35-36(8,9)26(3,4)5/h10-14,17-18,20-24,28H,15-16H2,1-9H3/t17-,18+,20-,21?,22+,23-,24+,27+/m1/s1 |
| InChIKey | DHOVYQAHNJVHOE-YTVUTXSLSA-N |
| XLogP | 4.65 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|