C26H22O4 — CID 53386976
methyl 2-[(R)-(4-methylphenyl)-[(3S)-2-oxo-3-phenyl-1-benzofuran-3-yl]methyl]prop-2-enoate (PubChem CID 53386976) has the molecular formula C26H22O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl 2-[(R)-(4-methylphenyl)-[(3S)-2-oxo-3-phenyl-1-benzofuran-3-yl]methyl]prop-2-enoate.
| Compound Name | methyl 2-[(R)-(4-methylphenyl)-[(3S)-2-oxo-3-phenyl-1-benzofuran-3-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 53386976 |
| Molecular Formula | C26H22O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | methyl 2-[(R)-(4-methylphenyl)-[(3S)-2-oxo-3-phenyl-1-benzofuran-3-yl]methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H](c1ccc(C)cc1)[C@@]1(c2ccccc2)C(=O)Oc2ccccc21 |
| InChI | InChI=1S/C26H22O4/c1-17-13-15-19(16-14-17)23(18(2)24(27)29-3)26(20-9-5-4-6-10-20)21-11-7-8-12-22(21)30-25(26)28/h4-16,23H,2H2,1,3H3/t23-,26-/m0/s1 |
| InChIKey | PUROARDOEGBWLF-OZXSUGGESA-N |
| XLogP | 4.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|