C25H19BrO4 — CID 66559829
methyl 2-[(S)-[(3S)-5-bromo-2-oxo-3-phenyl-1-benzofuran-3-yl]-phenylmethyl]prop-2-enoate (PubChem CID 66559829) has the molecular formula C25H19BrO4 and a molecular weight of 463.33 g/mol. Its IUPAC name is methyl 2-[(S)-[(3S)-5-bromo-2-oxo-3-phenyl-1-benzofuran-3-yl]-phenylmethyl]prop-2-enoate.
| Compound Name | methyl 2-[(S)-[(3S)-5-bromo-2-oxo-3-phenyl-1-benzofuran-3-yl]-phenylmethyl]prop-2-enoate |
|---|---|
| PubChem CID | 66559829 |
| Molecular Formula | C25H19BrO4 |
| Molecular Weight | 463.33 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | methyl 2-[(S)-[(3S)-5-bromo-2-oxo-3-phenyl-1-benzofuran-3-yl]-phenylmethyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H](c1ccccc1)[C@@]1(c2ccccc2)C(=O)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C25H19BrO4/c1-16(23(27)29-2)22(17-9-5-3-6-10-17)25(18-11-7-4-8-12-18)20-15-19(26)13-14-21(20)30-24(25)28/h3-15,22H,1H2,2H3/t22-,25+/m1/s1 |
| InChIKey | GVNWUKBGUUMTRN-RDGATRHJSA-N |
| XLogP | 5.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|