C17H23NSi — CID 53387618
2-(1-benzyl-1-azaspiro[2.3]hexan-2-yl)ethynyl-trimethylsilane (PubChem CID 53387618) has the molecular formula C17H23NSi and a molecular weight of 269.46 g/mol. Its IUPAC name is 2-(1-benzyl-1-azaspiro[2.3]hexan-2-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(1-benzyl-1-azaspiro[2.3]hexan-2-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 53387618 |
| Molecular Formula | C17H23NSi |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(1-benzyl-1-azaspiro[2.3]hexan-2-yl)ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#CC1N(Cc2ccccc2)C12CCC2 |
| InChI | InChI=1S/C17H23NSi/c1-19(2,3)13-10-16-17(11-7-12-17)18(16)14-15-8-5-4-6-9-15/h4-6,8-9,16H,7,11-12,14H2,1-3H3 |
| InChIKey | PLXNKZXTQDUVNA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|