C23H33NO2Si — CID 71483629
trimethyl-[2-[(1R,5S,8S,12S)-5-(phenylmethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]ethynyl]silane (PubChem CID 71483629) has the molecular formula C23H33NO2Si and a molecular weight of 383.61 g/mol. Its IUPAC name is trimethyl-[2-[(1R,5S,8S,12S)-5-(phenylmethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(1R,5S,8S,12S)-5-(phenylmethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]ethynyl]silane |
|---|---|
| PubChem CID | 71483629 |
| Molecular Formula | C23H33NO2Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | trimethyl-[2-[(1R,5S,8S,12S)-5-(phenylmethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@@H]1[C@@H]2CCC[C@]13CCC[C@@H](COCc1ccccc1)N3O2 |
| InChI | InChI=1S/C23H33NO2Si/c1-27(2,3)16-13-21-22-12-8-15-23(21)14-7-11-20(24(23)26-22)18-25-17-19-9-5-4-6-10-19/h4-6,9-10,20-22H,7-8,11-12,14-15,17-18H2,1-3H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | AIBAXCPXYRFTIR-GSPCLOLRSA-N |
| XLogP | 4.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|