C21H28INO3 — CID 101185661
(5S)-12-[(Z)-2-iodoethenyl]-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecane (PubChem CID 101185661) has the molecular formula C21H28INO3 and a molecular weight of 469.36 g/mol. Its IUPAC name is (5S)-12-[(Z)-2-iodoethenyl]-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecane.
| Compound Name | (5S)-12-[(Z)-2-iodoethenyl]-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecane |
|---|---|
| PubChem CID | 101185661 |
| Molecular Formula | C21H28INO3 |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (5S)-12-[(Z)-2-iodoethenyl]-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecane |
| SMILES | I/C=C\C1C2CCCC13CCC[C@@H](COCOCc1ccccc1)N3O2 |
| InChI | InChI=1S/C21H28INO3/c22-13-10-19-20-9-5-12-21(19)11-4-8-18(23(21)26-20)15-25-16-24-14-17-6-2-1-3-7-17/h1-3,6-7,10,13,18-20H,4-5,8-9,11-12,14-16H2/b13-10-/t18-,19?,20?,21?/m0/s1 |
| InChIKey | OUKIADSCNMCCKU-MCNGUYBISA-N |
| XLogP | 4.83 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|