C26H37NO3Si — CID 101185662
trimethyl-[(Z)-4-[(5S)-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]but-3-en-1-ynyl]silane (PubChem CID 101185662) has the molecular formula C26H37NO3Si and a molecular weight of 439.67 g/mol. Its IUPAC name is trimethyl-[(Z)-4-[(5S)-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]but-3-en-1-ynyl]silane.
| Compound Name | trimethyl-[(Z)-4-[(5S)-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]but-3-en-1-ynyl]silane |
|---|---|
| PubChem CID | 101185662 |
| Molecular Formula | C26H37NO3Si |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | trimethyl-[(Z)-4-[(5S)-5-(phenylmethoxymethoxymethyl)-7-oxa-6-azatricyclo[6.3.1.01,6]dodecan-12-yl]but-3-en-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C=C\C1C2CCCC13CCC[C@@H](COCOCc1ccccc1)N3O2 |
| InChI | InChI=1S/C26H37NO3Si/c1-31(2,3)18-8-7-14-24-25-15-10-17-26(24)16-9-13-23(27(26)30-25)20-29-21-28-19-22-11-5-4-6-12-22/h4-7,11-12,14,23-25H,9-10,13,15-17,19-21H2,1-3H3/b14-7-/t23-,24?,25?,26?/m0/s1 |
| InChIKey | RTWOVMZVYCQWOG-WVAVNLJCSA-N |
| XLogP | 5.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|