C31H39N3O2 — CID 10941465
2,6-bis[[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]methyl]pyridine (PubChem CID 10941465) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 2,6-bis[[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 2,6-bis[[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 10941465 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 2,6-bis[[(2S)-2-(phenylmethoxymethyl)pyrrolidin-1-yl]methyl]pyridine |
| SMILES | c1ccc(COC[C@@H]2CCCN2Cc2cccc(CN3CCC[C@H]3COCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H39N3O2/c1-3-10-26(11-4-1)22-35-24-30-16-8-18-33(30)20-28-14-7-15-29(32-28)21-34-19-9-17-31(34)25-36-23-27-12-5-2-6-13-27/h1-7,10-15,30-31H,8-9,16-25H2/t30-,31-/m0/s1 |
| InChIKey | YNBVMLOUGFCLJZ-CONSDPRKSA-N |
| XLogP | 5.44 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |