C19H23NO3S — CID 53253656
4-benzyl-3-(phenylmethoxymethyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 53253656) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-benzyl-3-(phenylmethoxymethyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-benzyl-3-(phenylmethoxymethyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 53253656 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-benzyl-3-(phenylmethoxymethyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCN(Cc2ccccc2)C(COCc2ccccc2)C1 |
| InChI | InChI=1S/C19H23NO3S/c21-24(22)12-11-20(13-17-7-3-1-4-8-17)19(16-24)15-23-14-18-9-5-2-6-10-18/h1-10,19H,11-16H2 |
| InChIKey | MQXIJPYMOZJRLJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |