C17H24OSi — CID 10564136
trimethyl-[2-[(1R,2R,3R)-2-methyl-3-(phenylmethoxymethyl)cyclopropyl]ethynyl]silane (PubChem CID 10564136) has the molecular formula C17H24OSi and a molecular weight of 272.46 g/mol. Its IUPAC name is trimethyl-[2-[(1R,2R,3R)-2-methyl-3-(phenylmethoxymethyl)cyclopropyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(1R,2R,3R)-2-methyl-3-(phenylmethoxymethyl)cyclopropyl]ethynyl]silane |
|---|---|
| PubChem CID | 10564136 |
| Molecular Formula | C17H24OSi |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | trimethyl-[2-[(1R,2R,3R)-2-methyl-3-(phenylmethoxymethyl)cyclopropyl]ethynyl]silane |
| SMILES | C[C@@H]1[C@@H](C#C[Si](C)(C)C)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C17H24OSi/c1-14-16(10-11-19(2,3)4)17(14)13-18-12-15-8-6-5-7-9-15/h5-9,14,16-17H,12-13H2,1-4H3/t14-,16-,17-/m1/s1 |
| InChIKey | NDKRNPQVXPAXEU-DJIMGWMZSA-N |
| XLogP | 3.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|