C37H40O3Si — CID 175267001
trimethyl-[2-[(2S,5R,6R)-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]ethynyl]silane (PubChem CID 175267001) has the molecular formula C37H40O3Si and a molecular weight of 560.81 g/mol. Its IUPAC name is trimethyl-[2-[(2S,5R,6R)-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]ethynyl]silane.
| Compound Name | trimethyl-[2-[(2S,5R,6R)-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]ethynyl]silane |
|---|---|
| PubChem CID | 175267001 |
| Molecular Formula | C37H40O3Si |
| Molecular Weight | 560.81 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | trimethyl-[2-[(2S,5R,6R)-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@@H]1CC[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C37H40O3Si/c1-41(2,3)27-26-34-24-25-35(36(39-34)29-38-28-30-16-8-4-9-17-30)40-37(31-18-10-5-11-19-31,32-20-12-6-13-21-32)33-22-14-7-15-23-33/h4-23,34-36H,24-25,28-29H2,1-3H3/t34-,35+,36+/m0/s1 |
| InChIKey | FASVGOMVVUTYEH-LIVOIKKVSA-N |
| XLogP | 8.01 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.81 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|