C45H48O11 — CID 171127058
(2S,3S,4R,5S,6R)-5-[(2R,3S,4S,5S,6R)-3,4-dihydroxy-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]oxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol (PubChem CID 171127058) has the molecular formula C45H48O11 and a molecular weight of 764.87 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-5-[(2R,3S,4S,5S,6R)-3,4-dihydroxy-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]oxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol.
| Compound Name | (2S,3S,4R,5S,6R)-5-[(2R,3S,4S,5S,6R)-3,4-dihydroxy-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]oxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol |
|---|---|
| PubChem CID | 171127058 |
| Molecular Formula | C45H48O11 |
| Molecular Weight | 764.87 g/mol |
| Exact Mass | 764.32 |
| IUPAC Name | (2S,3S,4R,5S,6R)-5-[(2R,3S,4S,5S,6R)-3,4-dihydroxy-6-(phenylmethoxymethyl)-5-trityloxyoxan-2-yl]oxy-6-(phenylmethoxymethyl)oxane-2,3,4-triol |
| SMILES | O[C@@H]1[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@@H](O)O[C@@H]2COCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1O |
| InChI | InChI=1S/C45H48O11/c46-37-39(48)43(50)53-35(28-51-26-30-16-6-1-7-17-30)41(37)55-44-40(49)38(47)42(36(54-44)29-52-27-31-18-8-2-9-19-31)56-45(32-20-10-3-11-21-32,33-22-12-4-13-23-33)34-24-14-5-15-25-34/h1-25,35-44,46-50H,26-29H2/t35-,36-,37-,38+,39+,40+,41-,42-,43+,44-/m1/s1 |
| InChIKey | YLMGQPATKNKZIF-XKDRZQPRSA-N |
| XLogP | 4.07 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|