C56H101N11O12 — CID 53388012
tritert-butyl 10-[4-heptyl-6-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]-1,3,5-triazin-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate (PubChem CID 53388012) has the molecular formula C56H101N11O12 and a molecular weight of 1120.49 g/mol. Its IUPAC name is tritert-butyl 10-[4-heptyl-6-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]-1,3,5-triazin-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate.
| Compound Name | tritert-butyl 10-[4-heptyl-6-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]-1,3,5-triazin-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
|---|---|
| PubChem CID | 53388012 |
| Molecular Formula | C56H101N11O12 |
| Molecular Weight | 1120.49 g/mol |
| Exact Mass | 1119.76 |
| IUPAC Name | tritert-butyl 10-[4-heptyl-6-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]-1,3,5-triazin-2-yl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylate |
| SMILES | CCCCCCCc1nc(N2CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC2)nc(N2CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C56H101N11O12/c1-20-21-22-23-24-25-42-57-43(60-26-30-62(45(68)74-51(2,3)4)34-38-66(49(72)78-55(14,15)16)39-35-63(31-27-60)46(69)75-52(5,6)7)59-44(58-42)61-28-32-64(47(70)76-53(8,9)10)36-40-67(50(73)79-56(17,18)19)41-37-65(33-29-61)48(71)77-54(11,12)13/h20-41H2,1-19H3 |
| InChIKey | CHFMLQCDRBVYSI-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 222.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1120.49 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|