C15H24BrN5O2 — CID 82667884
tert-butyl 4-[4-(aminomethyl)-5-bromo-6-methylpyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 82667884) has the molecular formula C15H24BrN5O2 and a molecular weight of 386.29 g/mol. Its IUPAC name is tert-butyl 4-[4-(aminomethyl)-5-bromo-6-methylpyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(aminomethyl)-5-bromo-6-methylpyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 82667884 |
| Molecular Formula | C15H24BrN5O2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | tert-butyl 4-[4-(aminomethyl)-5-bromo-6-methylpyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | Cc1nc(N2CCN(C(=O)OC(C)(C)C)CC2)nc(CN)c1Br |
| InChI | InChI=1S/C15H24BrN5O2/c1-10-12(16)11(9-17)19-13(18-10)20-5-7-21(8-6-20)14(22)23-15(2,3)4/h5-9,17H2,1-4H3 |
| InChIKey | OACHMGXFUDKYTO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |