C19H18FN3O2S — CID 53388637
3-(4-fluorophenyl)-6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide (PubChem CID 53388637) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide.
| Compound Name | 3-(4-fluorophenyl)-6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 53388637 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-(4-fluorophenyl)-6,7-dimethoxy-3a,4-dihydro-3H-indeno[1,2-c]pyrazole-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C1=NN(C(N)=S)C(c3ccc(F)cc3)C1C2 |
| InChI | InChI=1S/C19H18FN3O2S/c1-24-15-8-11-7-14-17(13(11)9-16(15)25-2)22-23(19(21)26)18(14)10-3-5-12(20)6-4-10/h3-6,8-9,14,18H,7H2,1-2H3,(H2,21,26) |
| InChIKey | QPOVAXRQPIMWFQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|