C18H23NO8S — CID 53389151
1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-5-oxopyrrolidine-1,2-dicarboxylate (PubChem CID 53389151) has the molecular formula C18H23NO8S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-5-oxopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 53389151 |
| Molecular Formula | C18H23NO8S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-(4-methylphenyl)sulfonyloxy-5-oxopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OS(=O)(=O)c2ccc(C)cc2)C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H23NO8S/c1-11-6-8-12(9-7-11)28(23,24)27-14-10-13(16(21)25-5)19(15(14)20)17(22)26-18(2,3)4/h6-9,13-14H,10H2,1-5H3/t13-,14+/m0/s1 |
| InChIKey | FJVIREHYCNZSMV-UONOGXRCSA-N |
| XLogP | 1.78 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|