C25H38N6O — CID 53390397
5,6-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]pyrimidin-4-amine (PubChem CID 53390397) has the molecular formula C25H38N6O and a molecular weight of 438.62 g/mol. Its IUPAC name is 5,6-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 53390397 |
| Molecular Formula | C25H38N6O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | 5,6-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[2-(2-pyrrolidin-1-ylethoxy)ethyl]pyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccc(N3CCN(C)CC3)cc2)nc(NCCOCCN2CCCC2)c1C |
| InChI | InChI=1S/C25H38N6O/c1-20-21(2)27-25(22-6-8-23(9-7-22)31-15-13-29(3)14-16-31)28-24(20)26-10-18-32-19-17-30-11-4-5-12-30/h6-9H,4-5,10-19H2,1-3H3,(H,26,27,28) |
| InChIKey | BNSHCWBBZPIFCI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|