C26H34N8 — CID 71478723
8,9-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[4-(1H-pyrrol-3-yl)butyl]purin-6-amine (PubChem CID 71478723) has the molecular formula C26H34N8 and a molecular weight of 458.61 g/mol. Its IUPAC name is 8,9-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[4-(1H-pyrrol-3-yl)butyl]purin-6-amine.
| Compound Name | 8,9-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[4-(1H-pyrrol-3-yl)butyl]purin-6-amine |
|---|---|
| PubChem CID | 71478723 |
| Molecular Formula | C26H34N8 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 8,9-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-[4-(1H-pyrrol-3-yl)butyl]purin-6-amine |
| SMILES | Cc1nc2c(NCCCCc3cc[nH]c3)nc(-c3ccc(N4CCN(C)CC4)cc3)nc2n1C |
| InChI | InChI=1S/C26H34N8/c1-19-29-23-25(28-12-5-4-6-20-11-13-27-18-20)30-24(31-26(23)33(19)3)21-7-9-22(10-8-21)34-16-14-32(2)15-17-34/h7-11,13,18,27H,4-6,12,14-17H2,1-3H3,(H,28,30,31) |
| InChIKey | YGIZEOKHIOQVMY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|