C27H38N8O — CID 71479252
6,7-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(4-morpholin-4-ylbutyl)pteridin-4-amine (PubChem CID 71479252) has the molecular formula C27H38N8O and a molecular weight of 490.66 g/mol. Its IUPAC name is 6,7-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(4-morpholin-4-ylbutyl)pteridin-4-amine.
| Compound Name | 6,7-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(4-morpholin-4-ylbutyl)pteridin-4-amine |
|---|---|
| PubChem CID | 71479252 |
| Molecular Formula | C27H38N8O |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.32 |
| IUPAC Name | 6,7-dimethyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-N-(4-morpholin-4-ylbutyl)pteridin-4-amine |
| SMILES | Cc1nc2nc(-c3ccc(N4CCN(C)CC4)cc3)nc(NCCCCN3CCOCC3)c2nc1C |
| InChI | InChI=1S/C27H38N8O/c1-20-21(2)30-27-24(29-20)26(28-10-4-5-11-34-16-18-36-19-17-34)31-25(32-27)22-6-8-23(9-7-22)35-14-12-33(3)13-15-35/h6-9H,4-5,10-19H2,1-3H3,(H,28,30,31,32) |
| InChIKey | GXEUMNLCBXVEHM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|