C23H33N5O2 — CID 77435717
5-methyl-2-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine (PubChem CID 77435717) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-methyl-2-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine.
| Compound Name | 5-methyl-2-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 77435717 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | 5-methyl-2-[4-(1-methylpyrrolidin-3-yl)oxyphenyl]-N-(3-morpholin-4-ylpropyl)pyrimidin-4-amine |
| SMILES | Cc1cnc(-c2ccc(OC3CCN(C)C3)cc2)nc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C23H33N5O2/c1-18-16-25-23(26-22(18)24-9-3-10-28-12-14-29-15-13-28)19-4-6-20(7-5-19)30-21-8-11-27(2)17-21/h4-7,16,21H,3,8-15,17H2,1-2H3,(H,24,25,26) |
| InChIKey | SRJMIXLZTUVBDR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|