C17H25N5O2 — CID 20952697
3-(4-methoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazol-5-amine (PubChem CID 20952697) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazol-5-amine.
| Compound Name | 3-(4-methoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 20952697 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,4-oxadiazol-5-amine |
| SMILES | COc1ccc(-c2noc(NCCCN3CCN(C)CC3)n2)cc1 |
| InChI | InChI=1S/C17H25N5O2/c1-21-10-12-22(13-11-21)9-3-8-18-17-19-16(20-24-17)14-4-6-15(23-2)7-5-14/h4-7H,3,8-13H2,1-2H3,(H,18,19,20) |
| InChIKey | GKKARYDKAGSHSO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|