C22H22Cl2N4O4S — CID 53390586
1-[1-[3-cyano-2,4,5-trideuterio-6-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-3-prop-2-enylurea (PubChem CID 53390586) has the molecular formula C22H22Cl2N4O4S and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-[1-[3-cyano-2,4,5-trideuterio-6-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-3-prop-2-enylurea.
| Compound Name | 1-[1-[3-cyano-2,4,5-trideuterio-6-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 53390586 |
| Molecular Formula | C22H22Cl2N4O4S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[1-[3-cyano-2,4,5-trideuterio-6-(3,5-dichlorophenoxy)phenyl]sulfonylpiperidin-4-yl]-3-prop-2-enylurea |
| SMILES | [2H]c1c([2H])c(Oc2cc(Cl)cc(Cl)c2)c(S(=O)(=O)N2CCC(NC(=O)NCC=C)CC2)c([2H])c1C#N |
| InChI | InChI=1S/C22H22Cl2N4O4S/c1-2-7-26-22(29)27-18-5-8-28(9-6-18)33(30,31)21-10-15(14-25)3-4-20(21)32-19-12-16(23)11-17(24)13-19/h2-4,10-13,18H,1,5-9H2,(H2,26,27,29)/i3D,4D,10D |
| InChIKey | COGUJEVYQWRFQK-OLFMETMTSA-N |
| XLogP | 4.30 |
| TPSA | 111.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|