C19H23N — CID 53391517
(3aR,7aS)-2-methyl-7a-naphthalen-2-yl-3,3a,4,5,6,7-hexahydro-1H-isoindole (PubChem CID 53391517) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is (3aR,7aS)-2-methyl-7a-naphthalen-2-yl-3,3a,4,5,6,7-hexahydro-1H-isoindole.
| Compound Name | (3aR,7aS)-2-methyl-7a-naphthalen-2-yl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
|---|---|
| PubChem CID | 53391517 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (3aR,7aS)-2-methyl-7a-naphthalen-2-yl-3,3a,4,5,6,7-hexahydro-1H-isoindole |
| SMILES | CN1C[C@@H]2CCCC[C@]2(c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C19H23N/c1-20-13-18-8-4-5-11-19(18,14-20)17-10-9-15-6-2-3-7-16(15)12-17/h2-3,6-7,9-10,12,18H,4-5,8,11,13-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | BIDMNSYJUSJTRE-RBUKOAKNSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |