C19H18N2O4 — CID 53392515
ethyl 4-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]benzoate (PubChem CID 53392515) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is ethyl 4-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]benzoate.
| Compound Name | ethyl 4-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 53392515 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | ethyl 4-[(2-methyl-1,3-dioxoisoindol-4-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NCc2cccc3c2C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C19H18N2O4/c1-3-25-19(24)12-7-9-14(10-8-12)20-11-13-5-4-6-15-16(13)18(23)21(2)17(15)22/h4-10,20H,3,11H2,1-2H3 |
| InChIKey | RXFOPDYIWLCMBL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|