C21H39NO7Si — CID 53392638
tert-butyl (3aS,6S,6aS)-4-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 53392638) has the molecular formula C21H39NO7Si and a molecular weight of 445.63 g/mol. Its IUPAC name is tert-butyl (3aS,6S,6aS)-4-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,6S,6aS)-4-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 53392638 |
| Molecular Formula | C21H39NO7Si |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | tert-butyl (3aS,6S,6aS)-4-acetyloxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(=O)OC1[C@H]2OC(C)(C)O[C@H]2[C@H](CO[Si](C)(C)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H39NO7Si/c1-13(23)26-17-16-15(27-21(8,9)28-16)14(12-25-30(10,11)20(5,6)7)22(17)18(24)29-19(2,3)4/h14-17H,12H2,1-11H3/t14-,15-,16-,17?/m0/s1 |
| InChIKey | VKLVPKFHHSPRDT-RXMKTKRKSA-N |
| XLogP | 4.04 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|