C14H11N3 — CID 53392945
3-[(E)-2-pyridin-3-ylethenyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 53392945) has the molecular formula C14H11N3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-[(E)-2-pyridin-3-ylethenyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-[(E)-2-pyridin-3-ylethenyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 53392945 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-[(E)-2-pyridin-3-ylethenyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C(=C/c1c[nH]c2ncccc12)\c1cccnc1 |
| InChI | InChI=1S/C14H11N3/c1-3-11(9-15-7-1)5-6-12-10-17-14-13(12)4-2-8-16-14/h1-10H,(H,16,17)/b6-5+ |
| InChIKey | LKEMLXRYKJZZDA-AATRIKPKSA-N |
| XLogP | 3.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |