C15H10N4 — CID 75306329
3-pyridin-3-yl-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enenitrile (PubChem CID 75306329) has the molecular formula C15H10N4 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-pyridin-3-yl-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enenitrile.
| Compound Name | 3-pyridin-3-yl-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 75306329 |
| Molecular Formula | C15H10N4 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 3-pyridin-3-yl-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccnc1)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C15H10N4/c16-8-12(7-11-3-1-5-17-9-11)14-10-19-15-13(14)4-2-6-18-15/h1-7,9-10H,(H,18,19) |
| InChIKey | BYUPNMOFJSAIHN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|