C20H16N4O2 — CID 52939019
(E)-2-cyano-N,N-dimethyl-3-[3-(1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]prop-2-enamide (PubChem CID 52939019) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is (E)-2-cyano-N,N-dimethyl-3-[3-(1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N,N-dimethyl-3-[3-(1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 52939019 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (E)-2-cyano-N,N-dimethyl-3-[3-(1H-pyrrolo[2,3-b]pyridine-3-carbonyl)phenyl]prop-2-enamide |
| SMILES | CN(C)C(=O)/C(C#N)=C/c1cccc(C(=O)c2c[nH]c3ncccc23)c1 |
| InChI | InChI=1S/C20H16N4O2/c1-24(2)20(26)15(11-21)10-13-5-3-6-14(9-13)18(25)17-12-23-19-16(17)7-4-8-22-19/h3-10,12H,1-2H3,(H,22,23)/b15-10+ |
| InChIKey | ONYKCRXFMUZZBQ-XNTDXEJSSA-N |
| XLogP | 2.79 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|