C16H11N3O4S — CID 171787551
[3-[(Z)-1-cyano-2-pyridin-3-ylethenyl]-1H-indol-5-yl] hydrogen sulfate (PubChem CID 171787551) has the molecular formula C16H11N3O4S and a molecular weight of 341.35 g/mol. Its IUPAC name is [3-[(Z)-1-cyano-2-pyridin-3-ylethenyl]-1H-indol-5-yl] hydrogen sulfate.
| Compound Name | [3-[(Z)-1-cyano-2-pyridin-3-ylethenyl]-1H-indol-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 171787551 |
| Molecular Formula | C16H11N3O4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | [3-[(Z)-1-cyano-2-pyridin-3-ylethenyl]-1H-indol-5-yl] hydrogen sulfate |
| SMILES | N#C/C(=C\c1cccnc1)c1c[nH]c2ccc(OS(=O)(=O)O)cc12 |
| InChI | InChI=1S/C16H11N3O4S/c17-8-12(6-11-2-1-5-18-9-11)15-10-19-16-4-3-13(7-14(15)16)23-24(20,21)22/h1-7,9-10,19H,(H,20,21,22)/b12-6+ |
| InChIKey | PXVARFAVQYMADY-WUXMJOGZSA-N |
| XLogP | 2.81 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|