C17H12ClN3O — CID 67514149
(E)-3-(4-chloro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile (PubChem CID 67514149) has the molecular formula C17H12ClN3O and a molecular weight of 309.76 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-chloro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 67514149 |
| Molecular Formula | C17H12ClN3O |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (E)-3-(4-chloro-3-pyridinyl)-2-(5-methoxy-1H-indol-3-yl)prop-2-enenitrile |
| SMILES | COc1ccc2[nH]cc(/C(C#N)=C\c3cnccc3Cl)c2c1 |
| InChI | InChI=1S/C17H12ClN3O/c1-22-13-2-3-17-14(7-13)15(10-21-17)11(8-19)6-12-9-20-5-4-16(12)18/h2-7,9-10,21H,1H3/b11-6- |
| InChIKey | IPWGNLMHMMBVSE-WDZFZDKYSA-N |
| XLogP | 4.29 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|