C17H12BrN3O — CID 90204768
(Z)-2-(5-bromo-1H-indol-3-yl)-3-(2-methoxy-3-pyridinyl)prop-2-enenitrile (PubChem CID 90204768) has the molecular formula C17H12BrN3O and a molecular weight of 354.21 g/mol. Its IUPAC name is (Z)-2-(5-bromo-1H-indol-3-yl)-3-(2-methoxy-3-pyridinyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(5-bromo-1H-indol-3-yl)-3-(2-methoxy-3-pyridinyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 90204768 |
| Molecular Formula | C17H12BrN3O |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | (Z)-2-(5-bromo-1H-indol-3-yl)-3-(2-methoxy-3-pyridinyl)prop-2-enenitrile |
| SMILES | COc1ncccc1/C=C(\C#N)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C17H12BrN3O/c1-22-17-11(3-2-6-20-17)7-12(9-19)15-10-21-16-5-4-13(18)8-14(15)16/h2-8,10,21H,1H3/b12-7+ |
| InChIKey | QDLIHZAKOVIGIY-KPKJPENVSA-N |
| XLogP | 4.40 |
| TPSA | 61.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|