C34H23FN6O2 — CID 87428673
(2Z,4Z)-4-(6-fluoro-3-pyridinyl)-2-(4-methoxy-1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-3-pyridin-3-ylhexa-2,4-dienedinitrile (PubChem CID 87428673) has the molecular formula C34H23FN6O2 and a molecular weight of 566.60 g/mol. Its IUPAC name is (2Z,4Z)-4-(6-fluoro-3-pyridinyl)-2-(4-methoxy-1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-3-pyridin-3-ylhexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-4-(6-fluoro-3-pyridinyl)-2-(4-methoxy-1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-3-pyridin-3-ylhexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 87428673 |
| Molecular Formula | C34H23FN6O2 |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | (2Z,4Z)-4-(6-fluoro-3-pyridinyl)-2-(4-methoxy-1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-3-pyridin-3-ylhexa-2,4-dienedinitrile |
| SMILES | COc1ccc2[nH]cc(/C(C#N)=C(C(=C(\C#N)c3c[nH]c4cccc(OC)c34)\c3cccnc3)/c3ccc(F)nc3)c2c1 |
| InChI | InChI=1S/C34H23FN6O2/c1-42-22-9-10-28-23(13-22)26(18-39-28)24(14-36)33(21-8-11-31(35)41-17-21)32(20-5-4-12-38-16-20)25(15-37)27-19-40-29-6-3-7-30(43-2)34(27)29/h3-13,16-19,39-40H,1-2H3/b32-25-,33-24- |
| InChIKey | ZDEMCUCNCHKWOH-SPZYBIOISA-N |
| XLogP | 7.16 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|