C42H30BrClFN7O — CID 90203824
(2Z,4Z)-2-(5-bromo-1H-indol-3-yl)-5-(5-chloro-1H-indol-3-yl)-3-[4-(diethylamino)-3-pyridinyl]-4-[4-(4-fluorophenoxy)-3-pyridinyl]hexa-2,4-dienedinitrile (PubChem CID 90203824) has the molecular formula C42H30BrClFN7O and a molecular weight of 783.11 g/mol. Its IUPAC name is (2Z,4Z)-2-(5-bromo-1H-indol-3-yl)-5-(5-chloro-1H-indol-3-yl)-3-[4-(diethylamino)-3-pyridinyl]-4-[4-(4-fluorophenoxy)-3-pyridinyl]hexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-2-(5-bromo-1H-indol-3-yl)-5-(5-chloro-1H-indol-3-yl)-3-[4-(diethylamino)-3-pyridinyl]-4-[4-(4-fluorophenoxy)-3-pyridinyl]hexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 90203824 |
| Molecular Formula | C42H30BrClFN7O |
| Molecular Weight | 783.11 g/mol |
| Exact Mass | 781.14 |
| IUPAC Name | (2Z,4Z)-2-(5-bromo-1H-indol-3-yl)-5-(5-chloro-1H-indol-3-yl)-3-[4-(diethylamino)-3-pyridinyl]-4-[4-(4-fluorophenoxy)-3-pyridinyl]hexa-2,4-dienedinitrile |
| SMILES | CCN(CC)c1ccncc1C(/C(=C(/C#N)c1c[nH]c2ccc(Cl)cc12)c1cnccc1Oc1ccc(F)cc1)=C(\C#N)c1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C42H30BrClFN7O/c1-3-52(4-2)39-13-15-48-21-35(39)41(31(19-46)33-23-50-37-11-5-25(43)17-29(33)37)42(32(20-47)34-24-51-38-12-6-26(44)18-30(34)38)36-22-49-16-14-40(36)53-28-9-7-27(45)8-10-28/h5-18,21-24,50-51H,3-4H2,1-2H3/b41-31-,42-32- |
| InChIKey | LNEQKISIZRZBFI-CMRZERMZSA-N |
| XLogP | 11.20 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.11 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|