C19H21NO5 — CID 53392956
4-(2-hydroxypropyl)-2-(4-methoxy-3-prop-2-enylphenyl)-6-nitrophenol (PubChem CID 53392956) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-(2-hydroxypropyl)-2-(4-methoxy-3-prop-2-enylphenyl)-6-nitrophenol.
| Compound Name | 4-(2-hydroxypropyl)-2-(4-methoxy-3-prop-2-enylphenyl)-6-nitrophenol |
|---|---|
| PubChem CID | 53392956 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 4-(2-hydroxypropyl)-2-(4-methoxy-3-prop-2-enylphenyl)-6-nitrophenol |
| SMILES | C=CCc1cc(-c2cc(CC(C)O)cc([N+](=O)[O-])c2O)ccc1OC |
| InChI | InChI=1S/C19H21NO5/c1-4-5-15-11-14(6-7-18(15)25-3)16-9-13(8-12(2)21)10-17(19(16)22)20(23)24/h4,6-7,9-12,21-22H,1,5,8H2,2-3H3 |
| InChIKey | BSZABDYZLMEGIM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|