C6H10ClN3O2 — CID 53398858
2-(2-aminoethyl)-1H-pyridazine-3,6-dione;hydrochloride (PubChem CID 53398858) has the molecular formula C6H10ClN3O2 and a molecular weight of 191.62 g/mol. Its IUPAC name is 2-(2-aminoethyl)-1H-pyridazine-3,6-dione;hydrochloride.
| Compound Name | 2-(2-aminoethyl)-1H-pyridazine-3,6-dione;hydrochloride |
|---|---|
| PubChem CID | 53398858 |
| Molecular Formula | C6H10ClN3O2 |
| Molecular Weight | 191.62 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 2-(2-aminoethyl)-1H-pyridazine-3,6-dione;hydrochloride |
| SMILES | Cl.NCCn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C6H9N3O2.ClH/c7-3-4-9-6(11)2-1-5(10)8-9;/h1-2H,3-4,7H2,(H,8,10);1H |
| InChIKey | CDOCBUDXPUDEKZ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.62 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |