C6H4IN3 — CID 53399429
3-iodo-2H-pyrazolo[3,4-c]pyridine (PubChem CID 53399429) has the molecular formula C6H4IN3 and a molecular weight of 245.02 g/mol. Its IUPAC name is 3-iodo-2H-pyrazolo[3,4-c]pyridine.
| Compound Name | 3-iodo-2H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 53399429 |
| Molecular Formula | C6H4IN3 |
| Molecular Weight | 245.02 g/mol |
| Exact Mass | 244.94 |
| IUPAC Name | 3-iodo-2H-pyrazolo[3,4-c]pyridine |
| SMILES | Ic1[nH]nc2cnccc12 |
| InChI | InChI=1S/C6H4IN3/c7-6-4-1-2-8-3-5(4)9-10-6/h1-3H,(H,9,10) |
| InChIKey | BFJMHTOBRRZELQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.02 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|