C24H31BrN2O3 — CID 5340622
5-bromo-2-hydroxy-N-[(Z)-1-(4-nonoxyphenyl)ethylideneamino]benzamide (PubChem CID 5340622) has the molecular formula C24H31BrN2O3 and a molecular weight of 475.43 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(Z)-1-(4-nonoxyphenyl)ethylideneamino]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(Z)-1-(4-nonoxyphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 5340622 |
| Molecular Formula | C24H31BrN2O3 |
| Molecular Weight | 475.43 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(Z)-1-(4-nonoxyphenyl)ethylideneamino]benzamide |
| SMILES | CCCCCCCCCOc1ccc(/C(C)=N\NC(=O)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C24H31BrN2O3/c1-3-4-5-6-7-8-9-16-30-21-13-10-19(11-14-21)18(2)26-27-24(29)22-17-20(25)12-15-23(22)28/h10-15,17,28H,3-9,16H2,1-2H3,(H,27,29)/b26-18- |
| InChIKey | AQOGYONAPXSKSC-ITYLOYPMSA-N |
| XLogP | 6.44 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.43 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|