C19H22BClO3 — CID 53406356
2-(2-chloro-4-phenylmethoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane (PubChem CID 53406356) has the molecular formula C19H22BClO3 and a molecular weight of 344.65 g/mol. Its IUPAC name is 2-(2-chloro-4-phenylmethoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(2-chloro-4-phenylmethoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 53406356 |
| Molecular Formula | C19H22BClO3 |
| Molecular Weight | 344.65 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-(2-chloro-4-phenylmethoxyphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| SMILES | CC1CC(C)(C)OB(c2ccc(OCc3ccccc3)cc2Cl)O1 |
| InChI | InChI=1S/C19H22BClO3/c1-14-12-19(2,3)24-20(23-14)17-10-9-16(11-18(17)21)22-13-15-7-5-4-6-8-15/h4-11,14H,12-13H2,1-3H3 |
| InChIKey | NFQFGMCUMVWWLW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.65 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|