C10H14BClO2S — CID 99866417
(6S)-2-(4-chlorothiophen-3-yl)-4,4,6-trimethyl-1,3,2-dioxaborinane (PubChem CID 99866417) has the molecular formula C10H14BClO2S and a molecular weight of 244.55 g/mol. Its IUPAC name is (6S)-2-(4-chlorothiophen-3-yl)-4,4,6-trimethyl-1,3,2-dioxaborinane.
| Compound Name | (6S)-2-(4-chlorothiophen-3-yl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 99866417 |
| Molecular Formula | C10H14BClO2S |
| Molecular Weight | 244.55 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (6S)-2-(4-chlorothiophen-3-yl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| SMILES | C[C@H]1CC(C)(C)OB(c2cscc2Cl)O1 |
| InChI | InChI=1S/C10H14BClO2S/c1-7-4-10(2,3)14-11(13-7)8-5-15-6-9(8)12/h5-7H,4H2,1-3H3/t7-/m0/s1 |
| InChIKey | KRPQQQLAUROUEJ-ZETCQYMHSA-N |
| XLogP | 2.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|