C13H17BClFO2 — CID 102592405
2-(3-chloro-2-fluoro-5-methylphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane (PubChem CID 102592405) has the molecular formula C13H17BClFO2 and a molecular weight of 270.54 g/mol. Its IUPAC name is 2-(3-chloro-2-fluoro-5-methylphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-(3-chloro-2-fluoro-5-methylphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 102592405 |
| Molecular Formula | C13H17BClFO2 |
| Molecular Weight | 270.54 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(3-chloro-2-fluoro-5-methylphenyl)-4,4,6-trimethyl-1,3,2-dioxaborinane |
| SMILES | Cc1cc(Cl)c(F)c(B2OC(C)CC(C)(C)O2)c1 |
| InChI | InChI=1S/C13H17BClFO2/c1-8-5-10(12(16)11(15)6-8)14-17-9(2)7-13(3,4)18-14/h5-6,9H,7H2,1-4H3 |
| InChIKey | XUXNHFHJPZOXOA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.54 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|