C12H15BCl2O3 — CID 53433612
2,6-dichloro-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenol (PubChem CID 53433612) has the molecular formula C12H15BCl2O3 and a molecular weight of 288.97 g/mol. Its IUPAC name is 2,6-dichloro-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenol.
| Compound Name | 2,6-dichloro-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenol |
|---|---|
| PubChem CID | 53433612 |
| Molecular Formula | C12H15BCl2O3 |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 2,6-dichloro-4-(4,4,6-trimethyl-1,3,2-dioxaborinan-2-yl)phenol |
| SMILES | CC1CC(C)(C)OB(c2cc(Cl)c(O)c(Cl)c2)O1 |
| InChI | InChI=1S/C12H15BCl2O3/c1-7-6-12(2,3)18-13(17-7)8-4-9(14)11(16)10(15)5-8/h4-5,7,16H,6H2,1-3H3 |
| InChIKey | ADSABBVYMSMVHM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|